C19H23N3O7Si — CID 169330737
4-amino-5-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330737) has the molecular formula C19H23N3O7Si and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-amino-5-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330737 |
| Molecular Formula | C19H23N3O7Si |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-amino-5-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CO[Si](CCCOc1cccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1)(OC)OC |
| InChI | InChI=1S/C19H23N3O7Si/c1-26-30(27-2,28-3)9-5-8-29-13-7-4-6-12(10-13)22-15(23)11-14-16(17(22)20)19(25)21-18(14)24/h4,6-7,10-11H,5,8-9,20H2,1-3H3,(H,21,24,25) |
| InChIKey | WNRHYIJOIOTBBT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|