C18H17N3O5 — CID 169330590
butyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate (PubChem CID 169330590) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is butyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate.
| Compound Name | butyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 169330590 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | butyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate |
| SMILES | CCCCOC(=O)c1cccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C18H17N3O5/c1-2-3-7-26-18(25)10-5-4-6-11(8-10)21-13(22)9-12-14(15(21)19)17(24)20-16(12)23/h4-6,8-9H,2-3,7,19H2,1H3,(H,20,23,24) |
| InChIKey | NVHCNUJWROIKJR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|