C22H14N4O8 — CID 169329942
[2-(3-nitrophenyl)-2-oxoethyl] 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate (PubChem CID 169329942) has the molecular formula C22H14N4O8 and a molecular weight of 462.37 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 169329942 |
| Molecular Formula | C22H14N4O8 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)benzoate |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)c1)C(=O)NC2=O |
| InChI | InChI=1S/C22H14N4O8/c23-19-18-15(20(29)24-21(18)30)9-17(28)25(19)13-5-2-4-12(8-13)22(31)34-10-16(27)11-3-1-6-14(7-11)26(32)33/h1-9H,10,23H2,(H,24,29,30) |
| InChIKey | XDBPHIQDKVPFBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 180.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|