C17H17N5O4 — CID 169327801
N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-2-(dimethylamino)acetamide (PubChem CID 169327801) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 169327801 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1cccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C17H17N5O4/c1-21(2)8-12(23)19-9-4-3-5-10(6-9)22-13(24)7-11-14(15(22)18)17(26)20-16(11)25/h3-7H,8,18H2,1-2H3,(H,19,23)(H,20,25,26) |
| InChIKey | NEVTXOIZCZEJQW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|