C22H18N4O4 — CID 169327829
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-ethyl-N-phenylbenzamide (PubChem CID 169327829) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-ethyl-N-phenylbenzamide.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 169327829 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O4/c1-2-25(14-6-4-3-5-7-14)22(30)13-8-10-15(11-9-13)26-17(27)12-16-18(19(26)23)21(29)24-20(16)28/h3-12H,2,23H2,1H3,(H,24,28,29) |
| InChIKey | VWWPFIJLRYHOPB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|