C21H16N6O3 — CID 169329939
4-amino-5-[2-(4-ethylphenyl)benzotriazol-5-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329939) has the molecular formula C21H16N6O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is 4-amino-5-[2-(4-ethylphenyl)benzotriazol-5-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(4-ethylphenyl)benzotriazol-5-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329939 |
| Molecular Formula | C21H16N6O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-amino-5-[2-(4-ethylphenyl)benzotriazol-5-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCc1ccc(-n2nc3ccc(-n4c(N)c5c(cc4=O)C(=O)NC5=O)cc3n2)cc1 |
| InChI | InChI=1S/C21H16N6O3/c1-2-11-3-5-12(6-4-11)27-24-15-8-7-13(9-16(15)25-27)26-17(28)10-14-18(19(26)22)21(30)23-20(14)29/h3-10H,2,22H2,1H3,(H,23,29,30) |
| InChIKey | ALPYGLKJSUIEIL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|