C18H20N4O4 — CID 169329816
4-amino-5-[3-(diethylaminomethyl)-4-hydroxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329816) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-amino-5-[3-(diethylaminomethyl)-4-hydroxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(diethylaminomethyl)-4-hydroxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329816 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-amino-5-[3-(diethylaminomethyl)-4-hydroxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCN(CC)Cc1cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)ccc1O |
| InChI | InChI=1S/C18H20N4O4/c1-3-21(4-2)9-10-7-11(5-6-13(10)23)22-14(24)8-12-15(16(22)19)18(26)20-17(12)25/h5-8,23H,3-4,9,19H2,1-2H3,(H,20,25,26) |
| InChIKey | TZHFIIKJKHFCLO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|