C22H18N4O6 — CID 169331409
3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-(3,4-dimethoxyphenyl)benzamide (PubChem CID 169331409) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-(3,4-dimethoxyphenyl)benzamide.
| Compound Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-(3,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 169331409 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-(3,4-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)c2)cc1OC |
| InChI | InChI=1S/C22H18N4O6/c1-31-15-7-6-12(9-16(15)32-2)24-20(28)11-4-3-5-13(8-11)26-17(27)10-14-18(19(26)23)22(30)25-21(14)29/h3-10H,23H2,1-2H3,(H,24,28)(H,25,29,30) |
| InChIKey | YVOQFQCQQVBNTP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|