C17H16N4O5 — CID 169329823
N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-methylphenyl]-2-methoxyacetamide (PubChem CID 169329823) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-methylphenyl]-2-methoxyacetamide.
| Compound Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-methylphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 169329823 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-methylphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(C)c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C17H16N4O5/c1-8-3-4-9(19-12(22)7-26-2)5-11(8)21-13(23)6-10-14(15(21)18)17(25)20-16(10)24/h3-6H,7,18H2,1-2H3,(H,19,22)(H,20,24,25) |
| InChIKey | SBQYVCDZHIQION-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|