C21H17N5O5 — CID 169329900
1-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-3-(4-methoxyphenyl)urea (PubChem CID 169329900) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is 1-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 169329900 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)cc2)cc1 |
| InChI | InChI=1S/C21H17N5O5/c1-31-14-8-4-12(5-9-14)24-21(30)23-11-2-6-13(7-3-11)26-16(27)10-15-17(18(26)22)20(29)25-19(15)28/h2-10H,22H2,1H3,(H2,23,24,30)(H,25,28,29) |
| InChIKey | IVHCQJYOIFJQDP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|