C16H15N3O5 — CID 169329378
4-amino-5-[3-(2-hydroxyethyl)-5-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329378) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 4-amino-5-[3-(2-hydroxyethyl)-5-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(2-hydroxyethyl)-5-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329378 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-amino-5-[3-(2-hydroxyethyl)-5-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(CCO)cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C16H15N3O5/c1-24-10-5-8(2-3-20)4-9(6-10)19-12(21)7-11-13(14(19)17)16(23)18-15(11)22/h4-7,20H,2-3,17H2,1H3,(H,18,22,23) |
| InChIKey | XEHAJGBHYVTCFQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|