C20H17N5O5S — CID 169327970
4-amino-5-[4-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327970) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is 4-amino-5-[4-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327970 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-amino-5-[4-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(OC)nc(CSc2ccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)cc2)n1 |
| InChI | InChI=1S/C20H17N5O5S/c1-29-14-8-15(30-2)23-13(22-14)9-31-11-5-3-10(4-6-11)25-16(26)7-12-17(18(25)21)20(28)24-19(12)27/h3-8H,9,21H2,1-2H3,(H,24,27,28) |
| InChIKey | YTDUXUANRUKSAE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|