C16H14N4O4 — CID 169330230
4-amino-5-(8-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330230) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-amino-5-(8-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(8-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330230 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-amino-5-(8-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(O)c3c1CCCN3)C(=O)NC2=O |
| InChI | InChI=1S/C16H14N4O4/c17-14-12-8(15(23)19-16(12)24)6-11(22)20(14)9-3-4-10(21)13-7(9)2-1-5-18-13/h3-4,6,18,21H,1-2,5,17H2,(H,19,23,24) |
| InChIKey | FIHOVOVYNJFNIO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|