C13H11Cl2IN2O2 — CID 134093607
3-(3,5-dichloro-4-iodophenyl)-6-propan-2-yl-1H-pyrimidine-2,4-dione (PubChem CID 134093607) has the molecular formula C13H11Cl2IN2O2 and a molecular weight of 425.05 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-iodophenyl)-6-propan-2-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(3,5-dichloro-4-iodophenyl)-6-propan-2-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134093607 |
| Molecular Formula | C13H11Cl2IN2O2 |
| Molecular Weight | 425.05 g/mol |
| Exact Mass | 423.92 |
| IUPAC Name | 3-(3,5-dichloro-4-iodophenyl)-6-propan-2-yl-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)c1cc(=O)n(-c2cc(Cl)c(I)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H11Cl2IN2O2/c1-6(2)10-5-11(19)18(13(20)17-10)7-3-8(14)12(16)9(15)4-7/h3-6H,1-2H3,(H,17,20) |
| InChIKey | JOXTWRVUOLKQRS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.05 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|