C11H7Cl2IN2O2 — CID 107605037
6-chloro-3-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrimidine-2,4-dione (PubChem CID 107605037) has the molecular formula C11H7Cl2IN2O2 and a molecular weight of 397.00 g/mol. Its IUPAC name is 6-chloro-3-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107605037 |
| Molecular Formula | C11H7Cl2IN2O2 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 6-chloro-3-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c(Cl)[nH]c(=O)n(-c2ccc(I)cc2Cl)c1=O |
| InChI | InChI=1S/C11H7Cl2IN2O2/c1-5-9(13)15-11(18)16(10(5)17)8-3-2-6(14)4-7(8)12/h2-4H,1H3,(H,15,18) |
| InChIKey | BLMIIJVPHKPUGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|