C10H9ClINO3S — CID 107606945
2-(2-chloro-4-iodophenyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 107606945) has the molecular formula C10H9ClINO3S and a molecular weight of 385.61 g/mol. Its IUPAC name is 2-(2-chloro-4-iodophenyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-(2-chloro-4-iodophenyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 107606945 |
| Molecular Formula | C10H9ClINO3S |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | 2-(2-chloro-4-iodophenyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(c2ccc(I)cc2Cl)S1(=O)=O |
| InChI | InChI=1S/C10H9ClINO3S/c1-10(2)9(14)13(17(10,15)16)8-4-3-6(12)5-7(8)11/h3-5H,1-2H3 |
| InChIKey | VDFCJADKIQZYAE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|