C11H11ClN2O3S2 — CID 79876304
4-chloro-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide (PubChem CID 79876304) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 4-chloro-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 79876304 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 4-chloro-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide |
| SMILES | CC1(C)C(=O)N(c2cc(Cl)ccc2C(N)=S)S1(=O)=O |
| InChI | InChI=1S/C11H11ClN2O3S2/c1-11(2)10(15)14(19(11,16)17)8-5-6(12)3-4-7(8)9(13)18/h3-5H,1-2H3,(H2,13,18) |
| InChIKey | BTJTYTGWUXGABY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|