C13H16ClN3OS — CID 63606090
5-chloro-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide (PubChem CID 63606090) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 5-chloro-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63606090 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-chloro-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide |
| SMILES | CC1(C)C(=O)NCCN1c1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C13H16ClN3OS/c1-13(2)12(18)16-5-6-17(13)10-4-3-8(14)7-9(10)11(15)19/h3-4,7H,5-6H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | AFHGFFZWAJVYEC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|