About 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide
4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide (PubChem CID 63605920) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide |
| PubChem CID | 63605920 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide |
| SMILES | CC1(C)C(=O)NCCN1c1ccnc(C(N)=S)c1 |
| InChI | InChI=1S/C12H16N4OS/c1-12(2)11(17)15-5-6-16(12)8-3-4-14-9(7-8)10(13)18/h3-4,7H,5-6H2,1-2H3,(H2,13,18)(H,15,17) |
| InChIKey | HHDYXRCUJNXIDA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide?
The IUPAC name of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide (CID 63605920) is 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide.
What is the SMILES notation for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide?
The canonical SMILES for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide is CC1(C)C(=O)NCCN1c1ccnc(C(N)=S)c1.
What is the InChIKey of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide?
The InChIKey is HHDYXRCUJNXIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-12(2)11(17)15-5-6-16(12)8-3-4-14-9(7-8)10(13)18/h3-4,7H,5-6H2,1-2H3,(H2,13,18)(H,15,17).
What are the key properties of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide?
4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide has a molecular weight of 264.35 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)pyridine-2-carbothioamide is sourced from PubChem (CID 63605920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).