C14H20N4OS — CID 63605748
2-(2,2-dimethyl-3-oxopiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 63605748) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-oxopiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(2,2-dimethyl-3-oxopiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63605748 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-(2,2-dimethyl-3-oxopiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(N2CCNC(=O)C2(C)C)n1 |
| InChI | InChI=1S/C14H20N4OS/c1-8-7-9(2)17-12(10(8)11(15)20)18-6-5-16-13(19)14(18,3)4/h7H,5-6H2,1-4H3,(H2,15,20)(H,16,19) |
| InChIKey | SQJONXLMPSTRJY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|