C11H13ClN2O2S2 — CID 79579600
4-chloro-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide (PubChem CID 79579600) has the molecular formula C11H13ClN2O2S2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-chloro-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 79579600 |
| Molecular Formula | C11H13ClN2O2S2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 4-chloro-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide |
| SMILES | CC1CN(c2cc(Cl)ccc2C(N)=S)S(=O)(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O2S2/c1-7-5-14(18(15,16)6-7)10-4-8(12)2-3-9(10)11(13)17/h2-4,7H,5-6H2,1H3,(H2,13,17) |
| InChIKey | WIDZDARADDHNQD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|