C12H16N2O2S2 — CID 79580098
4-methyl-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide (PubChem CID 79580098) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-methyl-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide.
| Compound Name | 4-methyl-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 79580098 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-methyl-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)cc1N1CC(C)CS1(=O)=O |
| InChI | InChI=1S/C12H16N2O2S2/c1-8-6-14(18(15,16)7-8)11-5-10(12(13)17)4-3-9(11)2/h3-5,8H,6-7H2,1-2H3,(H2,13,17) |
| InChIKey | XHPWHAZTCRRLBZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|