C10H11ClINO2S — CID 107641044
2-(4-chloro-2-iodophenyl)-4-methyl-1,2-thiazolidine 1,1-dioxide (PubChem CID 107641044) has the molecular formula C10H11ClINO2S and a molecular weight of 371.63 g/mol. Its IUPAC name is 2-(4-chloro-2-iodophenyl)-4-methyl-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-(4-chloro-2-iodophenyl)-4-methyl-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 107641044 |
| Molecular Formula | C10H11ClINO2S |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | 2-(4-chloro-2-iodophenyl)-4-methyl-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC1CN(c2ccc(Cl)cc2I)S(=O)(=O)C1 |
| InChI | InChI=1S/C10H11ClINO2S/c1-7-5-13(16(14,15)6-7)10-3-2-8(11)4-9(10)12/h2-4,7H,5-6H2,1H3 |
| InChIKey | VKDHLYYTBVNGIC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|