C13H17ClIN — CID 107641033
1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine (PubChem CID 107641033) has the molecular formula C13H17ClIN and a molecular weight of 349.64 g/mol. Its IUPAC name is 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine.
| Compound Name | 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine |
|---|---|
| PubChem CID | 107641033 |
| Molecular Formula | C13H17ClIN |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine |
| SMILES | CCC1(CC)CN(c2ccc(Cl)cc2I)C1 |
| InChI | InChI=1S/C13H17ClIN/c1-3-13(4-2)8-16(9-13)12-6-5-10(14)7-11(12)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | WRNVCWKIWJNCIZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|