About 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine
1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine (PubChem CID 107641033) has the molecular formula C13H17ClIN
and a molecular weight of 349.64 g/mol. Its IUPAC name is 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine.
Molecular Properties
| Compound Name | 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine |
| PubChem CID | 107641033 |
| Molecular Formula | C13H17ClIN |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine |
| SMILES | CCC1(CC)CN(c2ccc(Cl)cc2I)C1 |
| InChI | InChI=1S/C13H17ClIN/c1-3-13(4-2)8-16(9-13)12-6-5-10(14)7-11(12)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | WRNVCWKIWJNCIZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine?
The IUPAC name of 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine (CID 107641033) is 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine.
What is the SMILES notation for 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine?
The canonical SMILES for 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine is CCC1(CC)CN(c2ccc(Cl)cc2I)C1.
What is the InChIKey of 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine?
The InChIKey is WRNVCWKIWJNCIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClIN/c1-3-13(4-2)8-16(9-13)12-6-5-10(14)7-11(12)15/h5-7H,3-4,8-9H2,1-2H3.
What are the key properties of 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine?
1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine has a molecular weight of 349.64 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-iodophenyl)-3,3-diethylazetidine is sourced from PubChem (CID 107641033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).