C14H12ClIN2 — CID 107629433
2-(4-chloro-2-iodophenyl)-1,3-dihydroisoindol-5-amine (PubChem CID 107629433) has the molecular formula C14H12ClIN2 and a molecular weight of 370.62 g/mol. Its IUPAC name is 2-(4-chloro-2-iodophenyl)-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-(4-chloro-2-iodophenyl)-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 107629433 |
| Molecular Formula | C14H12ClIN2 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-(4-chloro-2-iodophenyl)-1,3-dihydroisoindol-5-amine |
| SMILES | Nc1ccc2c(c1)CN(c1ccc(Cl)cc1I)C2 |
| InChI | InChI=1S/C14H12ClIN2/c15-11-2-4-14(13(16)6-11)18-7-9-1-3-12(17)5-10(9)8-18/h1-6H,7-8,17H2 |
| InChIKey | WXLWKYONVUZIOD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|