C11H11BrN2O3S2 — CID 107789783
3-bromo-4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide (PubChem CID 107789783) has the molecular formula C11H11BrN2O3S2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-bromo-4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107789783 |
| Molecular Formula | C11H11BrN2O3S2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 3-bromo-4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzenecarbothioamide |
| SMILES | CC1(C)C(=O)N(c2ccc(C(N)=S)cc2Br)S1(=O)=O |
| InChI | InChI=1S/C11H11BrN2O3S2/c1-11(2)10(15)14(19(11,16)17)8-4-3-6(9(13)18)5-7(8)12/h3-5H,1-2H3,(H2,13,18) |
| InChIKey | PJXIMVAZGGVJMK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|