C15H17NO4S — CID 79875447
2-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79875447) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 79875447 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | Cc1ccc(C#CCCO)cc1N1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C15H17NO4S/c1-11-7-8-12(6-4-5-9-17)10-13(11)16-14(18)15(2,3)21(16,19)20/h7-8,10,17H,5,9H2,1-3H3 |
| InChIKey | HKXGPRYZKXYLOY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|