C10H9ClIN — CID 107606932
1-(2-chloro-4-iodophenyl)-2,5-dihydropyrrole (PubChem CID 107606932) has the molecular formula C10H9ClIN and a molecular weight of 305.55 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-2,5-dihydropyrrole.
| Compound Name | 1-(2-chloro-4-iodophenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 107606932 |
| Molecular Formula | C10H9ClIN |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-2,5-dihydropyrrole |
| SMILES | Clc1cc(I)ccc1N1CC=CC1 |
| InChI | InChI=1S/C10H9ClIN/c11-9-7-8(12)3-4-10(9)13-5-1-2-6-13/h1-4,7H,5-6H2 |
| InChIKey | CHZIGTCCOXIIHM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|