C14H16ClNO — CID 58270648
3-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]butan-2-one (PubChem CID 58270648) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 3-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]butan-2-one.
| Compound Name | 3-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 58270648 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]butan-2-one |
| SMILES | CC(=O)C(C)c1ccc(N2CC=CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClNO/c1-10(11(2)17)12-5-6-14(13(15)9-12)16-7-3-4-8-16/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | XDNAUIIBVAKRCG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|