C15H18ClNO2 — CID 139880340
ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate (PubChem CID 139880340) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate.
| Compound Name | ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 139880340 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(N2CC=CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO2/c1-3-19-15(18)11(2)12-6-7-14(13(16)10-12)17-8-4-5-9-17/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | GVFDOKOKJHREEP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|