C15H20ClIN2 — CID 107603949
2-(2-chloro-4-iodophenyl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine (PubChem CID 107603949) has the molecular formula C15H20ClIN2 and a molecular weight of 390.70 g/mol. Its IUPAC name is 2-(2-chloro-4-iodophenyl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine.
| Compound Name | 2-(2-chloro-4-iodophenyl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 107603949 |
| Molecular Formula | C15H20ClIN2 |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-(2-chloro-4-iodophenyl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
| SMILES | Clc1cc(I)ccc1N1CCCN2CCCCC2C1 |
| InChI | InChI=1S/C15H20ClIN2/c16-14-10-12(17)5-6-15(14)19-9-3-8-18-7-2-1-4-13(18)11-19/h5-6,10,13H,1-4,7-9,11H2 |
| InChIKey | GVLIPMKJPNQCTB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|