C14H20ClN3 — CID 63168533
3-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)aniline (PubChem CID 63168533) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 3-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)aniline.
| Compound Name | 3-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)aniline |
|---|---|
| PubChem CID | 63168533 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)aniline |
| SMILES | Nc1ccc(N2CCC(N3CCCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3/c15-13-9-11(16)3-4-14(13)18-8-5-12(10-18)17-6-1-2-7-17/h3-4,9,12H,1-2,5-8,10,16H2 |
| InChIKey | KWDKHGCLXOEKDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|