C14H18ClIN2 — CID 114261403
2-(2-chloro-5-iodophenyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 114261403) has the molecular formula C14H18ClIN2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 2-(2-chloro-5-iodophenyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-(2-chloro-5-iodophenyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 114261403 |
| Molecular Formula | C14H18ClIN2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-(2-chloro-5-iodophenyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | Clc1ccc(I)cc1N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C14H18ClIN2/c15-13-5-4-11(16)9-14(13)18-8-2-7-17-6-1-3-12(17)10-18/h4-5,9,12H,1-3,6-8,10H2 |
| InChIKey | JJOUWKIZBNFPGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|