C12H16ClIN2 — CID 107604020
1-(2-chloro-4-iodophenyl)-3,3-dimethylpiperazine (PubChem CID 107604020) has the molecular formula C12H16ClIN2 and a molecular weight of 350.63 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-3,3-dimethylpiperazine.
| Compound Name | 1-(2-chloro-4-iodophenyl)-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 107604020 |
| Molecular Formula | C12H16ClIN2 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-3,3-dimethylpiperazine |
| SMILES | CC1(C)CN(c2ccc(I)cc2Cl)CCN1 |
| InChI | InChI=1S/C12H16ClIN2/c1-12(2)8-16(6-5-15-12)11-4-3-9(14)7-10(11)13/h3-4,7,15H,5-6,8H2,1-2H3 |
| InChIKey | FKYCBNIMNINNOZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|