C14H20BrClN2 — CID 64925092
1-(4-bromo-2-chlorophenyl)-3,3-diethylpiperazine (PubChem CID 64925092) has the molecular formula C14H20BrClN2 and a molecular weight of 331.69 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3,3-diethylpiperazine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3,3-diethylpiperazine |
|---|---|
| PubChem CID | 64925092 |
| Molecular Formula | C14H20BrClN2 |
| Molecular Weight | 331.69 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3,3-diethylpiperazine |
| SMILES | CCC1(CC)CN(c2ccc(Br)cc2Cl)CCN1 |
| InChI | InChI=1S/C14H20BrClN2/c1-3-14(4-2)10-18(8-7-17-14)13-6-5-11(15)9-12(13)16/h5-6,9,17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | YZMCEOWWWDLJLY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |