C13H19BrN2O — CID 64954711
1-(5-bromo-2-methoxyphenyl)-3,3-dimethylpiperazine (PubChem CID 64954711) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3,3-dimethylpiperazine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 64954711 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3,3-dimethylpiperazine |
| SMILES | COc1ccc(Br)cc1N1CCNC(C)(C)C1 |
| InChI | InChI=1S/C13H19BrN2O/c1-13(2)9-16(7-6-15-13)11-8-10(14)4-5-12(11)17-3/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | MIPROJNAMCINRJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |