C16H25BrN2O — CID 64945226
1-(5-bromo-2-methoxyphenyl)-3-butan-2-yl-1,4-diazepane (PubChem CID 64945226) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-butan-2-yl-1,4-diazepane.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-butan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 64945226 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-butan-2-yl-1,4-diazepane |
| SMILES | CCC(C)C1CN(c2cc(Br)ccc2OC)CCCN1 |
| InChI | InChI=1S/C16H25BrN2O/c1-4-12(2)14-11-19(9-5-8-18-14)15-10-13(17)6-7-16(15)20-3/h6-7,10,12,14,18H,4-5,8-9,11H2,1-3H3 |
| InChIKey | JVZIFYCLGYBOBL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |