C17H28N2O2 — CID 64942271
3-butan-2-yl-1-(2,5-dimethoxyphenyl)-1,4-diazepane (PubChem CID 64942271) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,5-dimethoxyphenyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(2,5-dimethoxyphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64942271 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-butan-2-yl-1-(2,5-dimethoxyphenyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(c2cc(OC)ccc2OC)CCCN1 |
| InChI | InChI=1S/C17H28N2O2/c1-5-13(2)15-12-19(10-6-9-18-15)16-11-14(20-3)7-8-17(16)21-4/h7-8,11,13,15,18H,5-6,9-10,12H2,1-4H3 |
| InChIKey | SQCPBLIJDBSBRO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |