C16H26N2O2 — CID 64941914
1-(3,5-dimethoxyphenyl)-3-propan-2-yl-1,4-diazepane (PubChem CID 64941914) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-propan-2-yl-1,4-diazepane.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 64941914 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-propan-2-yl-1,4-diazepane |
| SMILES | COc1cc(OC)cc(N2CCCNC(C(C)C)C2)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)16-11-18(7-5-6-17-16)13-8-14(19-3)10-15(9-13)20-4/h8-10,12,16-17H,5-7,11H2,1-4H3 |
| InChIKey | DPCOQHBIFNSRIZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |