C17H27ClN2O — CID 64944553
3-butan-2-yl-1-(4-chloro-2-methoxy-5-methylphenyl)-1,4-diazepane (PubChem CID 64944553) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 3-butan-2-yl-1-(4-chloro-2-methoxy-5-methylphenyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(4-chloro-2-methoxy-5-methylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64944553 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-butan-2-yl-1-(4-chloro-2-methoxy-5-methylphenyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(c2cc(C)c(Cl)cc2OC)CCCN1 |
| InChI | InChI=1S/C17H27ClN2O/c1-5-12(2)15-11-20(8-6-7-19-15)16-9-13(3)14(18)10-17(16)21-4/h9-10,12,15,19H,5-8,11H2,1-4H3 |
| InChIKey | CYMGXCQYMLQOID-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |