C15H25N3 — CID 79043090
3-butan-2-yl-1-(2-methyl-3-pyridinyl)-1,4-diazepane (PubChem CID 79043090) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2-methyl-3-pyridinyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(2-methyl-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 79043090 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 3-butan-2-yl-1-(2-methyl-3-pyridinyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(c2cccnc2C)CCCN1 |
| InChI | InChI=1S/C15H25N3/c1-4-12(2)14-11-18(10-6-9-17-14)15-7-5-8-16-13(15)3/h5,7-8,12,14,17H,4,6,9-11H2,1-3H3 |
| InChIKey | PJWKHMHCMVKKRU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |