C12H10Cl2FNO — CID 107577447
5,7-dichloro-6-fluoro-2-propan-2-yl-1H-quinolin-4-one (PubChem CID 107577447) has the molecular formula C12H10Cl2FNO and a molecular weight of 274.12 g/mol. Its IUPAC name is 5,7-dichloro-6-fluoro-2-propan-2-yl-1H-quinolin-4-one.
| Compound Name | 5,7-dichloro-6-fluoro-2-propan-2-yl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 107577447 |
| Molecular Formula | C12H10Cl2FNO |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 5,7-dichloro-6-fluoro-2-propan-2-yl-1H-quinolin-4-one |
| SMILES | CC(C)c1cc(=O)c2c(Cl)c(F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C12H10Cl2FNO/c1-5(2)7-4-9(17)10-8(16-7)3-6(13)12(15)11(10)14/h3-5H,1-2H3,(H,16,17) |
| InChIKey | GWCZYPVVYIRLGZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|