C13H10Cl2FNO — CID 107577450
6,8-dichloro-7-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 107577450) has the molecular formula C13H10Cl2FNO and a molecular weight of 286.13 g/mol. Its IUPAC name is 6,8-dichloro-7-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 6,8-dichloro-7-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 107577450 |
| Molecular Formula | C13H10Cl2FNO |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 6,8-dichloro-7-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | O=c1c2c([nH]c3cc(Cl)c(F)c(Cl)c13)CCCC2 |
| InChI | InChI=1S/C13H10Cl2FNO/c14-7-5-9-10(11(15)12(7)16)13(18)6-3-1-2-4-8(6)17-9/h5H,1-4H2,(H,17,18) |
| InChIKey | NLBCUQCLAZUUIE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|