C18H14ClNO2 — CID 172712083
7-(4-chlorophenoxy)-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one (PubChem CID 172712083) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 7-(4-chlorophenoxy)-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one.
| Compound Name | 7-(4-chlorophenoxy)-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one |
|---|---|
| PubChem CID | 172712083 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 7-(4-chlorophenoxy)-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one |
| SMILES | O=c1c2c([nH]c3ccc(Oc4ccc(Cl)cc4)cc13)CCC2 |
| InChI | InChI=1S/C18H14ClNO2/c19-11-4-6-12(7-5-11)22-13-8-9-17-15(10-13)18(21)14-2-1-3-16(14)20-17/h4-10H,1-3H2,(H,20,21) |
| InChIKey | FJPUKVJGPHFFTA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |