C14H12BrCl2NO — CID 107792833
2-bromo-3,4-dichloro-5,6,7,8,9,10-hexahydrocyclohepta[b]quinolin-11-one (PubChem CID 107792833) has the molecular formula C14H12BrCl2NO and a molecular weight of 361.07 g/mol. Its IUPAC name is 2-bromo-3,4-dichloro-5,6,7,8,9,10-hexahydrocyclohepta[b]quinolin-11-one.
| Compound Name | 2-bromo-3,4-dichloro-5,6,7,8,9,10-hexahydrocyclohepta[b]quinolin-11-one |
|---|---|
| PubChem CID | 107792833 |
| Molecular Formula | C14H12BrCl2NO |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-bromo-3,4-dichloro-5,6,7,8,9,10-hexahydrocyclohepta[b]quinolin-11-one |
| SMILES | O=c1c2c([nH]c3c(Cl)c(Cl)c(Br)cc13)CCCCC2 |
| InChI | InChI=1S/C14H12BrCl2NO/c15-9-6-8-13(12(17)11(9)16)18-10-5-3-1-2-4-7(10)14(8)19/h6H,1-5H2,(H,18,19) |
| InChIKey | KDNYZIVVNDPYJD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|