C11H9BrClN — CID 10923627
5-bromo-7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 10923627) has the molecular formula C11H9BrClN and a molecular weight of 270.56 g/mol. Its IUPAC name is 5-bromo-7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 5-bromo-7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 10923627 |
| Molecular Formula | C11H9BrClN |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 5-bromo-7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | Clc1cc(Br)c2[nH]c3c(c2c1)CCC3 |
| InChI | InChI=1S/C11H9BrClN/c12-9-5-6(13)4-8-7-2-1-3-10(7)14-11(8)9/h4-5,14H,1-3H2 |
| InChIKey | IHFFWIINABLYIL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|