C12H8BrF2NO — CID 102854731
8-bromo-5,7-difluoro-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one (PubChem CID 102854731) has the molecular formula C12H8BrF2NO and a molecular weight of 300.10 g/mol. Its IUPAC name is 8-bromo-5,7-difluoro-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one.
| Compound Name | 8-bromo-5,7-difluoro-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one |
|---|---|
| PubChem CID | 102854731 |
| Molecular Formula | C12H8BrF2NO |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 8-bromo-5,7-difluoro-1,2,3,4-tetrahydrocyclopenta[b]quinolin-9-one |
| SMILES | O=c1c2c([nH]c3c(F)cc(F)c(Br)c13)CCC2 |
| InChI | InChI=1S/C12H8BrF2NO/c13-10-6(14)4-7(15)11-9(10)12(17)5-2-1-3-8(5)16-11/h4H,1-3H2,(H,16,17) |
| InChIKey | KXNZLPARCYHYOO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|