C12H13ClN2O2 — CID 91265163
3-(3-chlorophenyl)-4-hydroxy-5-propan-2-yl-1H-imidazol-2-one (PubChem CID 91265163) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-hydroxy-5-propan-2-yl-1H-imidazol-2-one.
| Compound Name | 3-(3-chlorophenyl)-4-hydroxy-5-propan-2-yl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 91265163 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-(3-chlorophenyl)-4-hydroxy-5-propan-2-yl-1H-imidazol-2-one |
| SMILES | CC(C)c1[nH]c(=O)n(-c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C12H13ClN2O2/c1-7(2)10-11(16)15(12(17)14-10)9-5-3-4-8(13)6-9/h3-7,16H,1-2H3,(H,14,17) |
| InChIKey | RVZJKQRVIXACGN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |