C21H13Cl3N2O2 — CID 91936514
1,3-bis(3-chlorophenyl)-4-(4-chlorophenyl)-5-hydroxyimidazol-2-one (PubChem CID 91936514) has the molecular formula C21H13Cl3N2O2 and a molecular weight of 431.71 g/mol. Its IUPAC name is 1,3-bis(3-chlorophenyl)-4-(4-chlorophenyl)-5-hydroxyimidazol-2-one.
| Compound Name | 1,3-bis(3-chlorophenyl)-4-(4-chlorophenyl)-5-hydroxyimidazol-2-one |
|---|---|
| PubChem CID | 91936514 |
| Molecular Formula | C21H13Cl3N2O2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 1,3-bis(3-chlorophenyl)-4-(4-chlorophenyl)-5-hydroxyimidazol-2-one |
| SMILES | O=c1n(-c2cccc(Cl)c2)c(O)c(-c2ccc(Cl)cc2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H13Cl3N2O2/c22-14-9-7-13(8-10-14)19-20(27)26(18-6-2-4-16(24)12-18)21(28)25(19)17-5-1-3-15(23)11-17/h1-12,27H |
| InChIKey | LPNSIKSULVCPTB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |