C11H7Br2ClN2O2 — CID 10620646
6-chloro-3-(2,4-dibromo-6-methylphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 10620646) has the molecular formula C11H7Br2ClN2O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 6-chloro-3-(2,4-dibromo-6-methylphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-(2,4-dibromo-6-methylphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10620646 |
| Molecular Formula | C11H7Br2ClN2O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | 6-chloro-3-(2,4-dibromo-6-methylphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(Br)cc(Br)c1-n1c(=O)cc(Cl)[nH]c1=O |
| InChI | InChI=1S/C11H7Br2ClN2O2/c1-5-2-6(12)3-7(13)10(5)16-9(17)4-8(14)15-11(16)18/h2-4H,1H3,(H,15,18) |
| InChIKey | YQFZBYLYDHAIFT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |